CAS 88718-93-8
:N-Hydroxy-1-methyl-1H-imidazol-2-amine
Description:
N-Hydroxy-1-methyl-1H-imidazol-2-amine, with the CAS number 88718-93-8, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a hydroxylamine functional group (-NHOH) attached to the imidazole, contributing to its reactivity and potential applications in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The presence of the methyl group enhances its solubility and may influence its biological activity. N-Hydroxy-1-methyl-1H-imidazol-2-amine is often studied for its role as a reagent in the formation of N-nitroso compounds and as a potential intermediate in the synthesis of pharmaceuticals. Its properties include being a solid at room temperature, with stability influenced by factors such as pH and temperature. As with many nitrogen-containing compounds, it may exhibit biological activity, warranting further investigation into its pharmacological properties and safety profile.
Formula:C4H7N3O
InChI:InChI=1S/C4H7N3O/c1-7-3-2-5-4(7)6-8/h2-3,8H,1H3,(H,5,6)
InChI key:InChIKey=JGBXVJJQHDVDQC-UHFFFAOYSA-N
SMILES:N(O)=C1N(C)C=CN1
Synonyms:- 2H-Imidazol-2-one, 1,3-dihydro-1-methyl-, oxime
- 2-Hydroxylamino-1-methylimidazole
- N-Hydroxy-1-methyl-1H-imidazol-2-amine
- 1H-Imidazol-2-amine, N-hydroxy-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
