CAS 887196-26-1
:(δS)-2-(4-Fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoic acid
Description:
The chemical substance known as (δS)-2-(4-Fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoic acid, with CAS number 887196-26-1, is a complex organic compound characterized by its multi-functional structure. It features a pyrrole ring, which is a five-membered aromatic heterocycle, and incorporates various substituents including a fluorophenyl group and a phenylamino carbonyl moiety. The presence of a hydroxy group and a branched alkyl chain contributes to its potential biological activity. This compound may exhibit specific stereochemistry, indicated by the (δS) designation, which can influence its interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular architecture, making it a subject of interest for further research in drug design and synthesis.
Formula:C33H35FN2O4
InChI:InChI=1S/C33H35FN2O4/c1-22(2)31-30(33(40)35-26-12-7-4-8-13-26)29(23-10-5-3-6-11-23)32(24-16-18-25(34)19-17-24)36(31)21-20-27(37)14-9-15-28(38)39/h3-8,10-13,16-19,22,27,37H,9,14-15,20-21H2,1-2H3,(H,35,40)(H,38,39)/t27-/m0/s1
InChI key:InChIKey=FXHZSTVKUASKCJ-MHZLTWQESA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2C(=C(N(CC[C@H](CCCC(O)=O)O)C2C(C)C)C3=CC=C(F)C=C3)C4=CC=CC=C4
Synonyms:- 1H-Pyrrole-1-heptanoic acid, 2-(4-fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-, (δS)-
- (δS)-2-(4-Fluorophenyl)-δ-hydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrole-1-heptanoic acid
- (S)-7-(2-(4-Fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl)-5-hydroxyheptanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5-Dehydroxy (3S)-Atorvastatin-d5
CAS:Controlled ProductFormula:C33D5H30FN2O4Color and Shape:NeatMolecular weight:547.6715-Dehydroxy (3S)-Atorvastatin
CAS:Controlled ProductFormula:C33H35FN2O4Color and Shape:NeatMolecular weight:542.64

