CAS 88720-45-0
:N-[(2-Chlorophenyl)methyl]glycine
Description:
N-[(2-Chlorophenyl)methyl]glycine, identified by its CAS number 88720-45-0, is an organic compound characterized by the presence of a glycine moiety substituted with a 2-chlorobenzyl group. This compound typically exhibits properties associated with amino acids, including the ability to participate in hydrogen bonding due to its amino and carboxylic acid functional groups. The presence of the 2-chlorophenyl group can influence its solubility, stability, and reactivity, often enhancing lipophilicity compared to non-substituted glycine derivatives. This substitution may also impart specific biological activities, making it of interest in pharmaceutical research. The compound is likely to be a white to off-white solid, with potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways. As with many organic compounds, safety and handling precautions should be observed, as the chlorinated aromatic structure may pose environmental and health risks.
Formula:C9H10ClNO2
InChI:InChI=1S/C9H10ClNO2/c10-8-4-2-1-3-7(8)5-11-6-9(12)13/h1-4,11H,5-6H2,(H,12,13)
InChI key:InChIKey=CBQHOZRSTUYWGQ-UHFFFAOYSA-N
SMILES:C(NCC(O)=O)C1=C(Cl)C=CC=C1
Synonyms:- 2-[[(2-Chlorophenyl)methyl]amino]acetic acid
- (2-Chloro-benzylamino)-acetic acid
- Glycine, N-[(2-chlorophenyl)methyl]-
- N-[(2-Chlorophenyl)methyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.