CAS 88720-62-1
:N-(pyridin-3-ylmethyl)glycine
Description:
N-(pyridin-3-ylmethyl)glycine, with the CAS number 88720-62-1, is an organic compound characterized by its structure, which includes a glycine moiety linked to a pyridine ring. This compound typically exhibits properties associated with both amino acids and heterocyclic aromatic compounds. It is likely to be a white to off-white solid, soluble in polar solvents such as water and methanol, due to the presence of the amino and carboxylic acid functional groups. The pyridine ring contributes to its potential as a ligand in coordination chemistry and may influence its biological activity, making it of interest in pharmaceutical research. The compound may also exhibit moderate stability under standard conditions, but its reactivity can vary depending on the functional groups present. Overall, N-(pyridin-3-ylmethyl)glycine is a versatile compound with potential applications in medicinal chemistry and biochemistry, particularly in the development of new therapeutic agents.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c11-8(12)6-10-5-7-2-1-3-9-4-7/h1-4,10H,5-6H2,(H,11,12)
SMILES:c1cc(cnc1)CNCC(=O)O
Synonyms:- [(Pyridin-3-Ylmethyl)Amino]Acetic Acid
- Nicotinylglycine
- N-Nicotinylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.