
CAS 88720-63-2
:N-(4-Pyridinylmethyl)glycine ethyl ester
Description:
N-(4-Pyridinylmethyl)glycine ethyl ester, with the CAS number 88720-63-2, is an organic compound characterized by its pyridine and glycine moieties. This substance features a pyridine ring substituted with a methyl group that is linked to the amino acid glycine, which is further esterified with an ethyl group. The presence of the pyridine ring imparts basic properties, while the glycine component contributes to its potential as an amino acid derivative. This compound is typically a white to off-white solid and is soluble in polar solvents, making it suitable for various applications in medicinal chemistry and biochemistry. Its structure suggests potential interactions with biological systems, possibly influencing neurotransmitter pathways or serving as a building block for more complex molecules. As with many derivatives of amino acids, it may exhibit interesting pharmacological properties, warranting further investigation for therapeutic uses. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-2-14-10(13)8-12-7-9-3-5-11-6-4-9/h3-6,12H,2,7-8H2,1H3
InChI key:InChIKey=PXTPPHVRRFSIRE-UHFFFAOYSA-N
SMILES:C(NCC(OCC)=O)C=1C=CN=CC1
Synonyms:- 2-[[(4-Pyridyl)methyl]amino]acetic acid ethyl ester
- Glycine, N-(4-pyridinylmethyl)-, ethyl ester
- N-(4-Pyridinylmethyl)glycine ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.