CAS 887202-44-0

4-[(Butylmethylamino)sulfonyl]benzoic acid

Description:

4-[(Butylmethylamino)sulfonyl]benzoic acid, identified by its CAS number 887202-44-0, is a chemical compound characterized by its sulfonamide functional group attached to a benzoic acid structure. This compound typically exhibits properties associated with both the sulfonamide and carboxylic acid functional groups, such as potential solubility in polar solvents and the ability to form hydrogen bonds. The presence of the butylmethylamino group suggests that it may have amphiphilic characteristics, which can influence its behavior in biological systems and its interaction with membranes. Additionally, the compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its molecular structure allows for various applications, including in drug development and as a reagent in organic synthesis. As with many sulfonamides, it may also possess antibacterial properties, although specific biological activities would require further investigation. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₇NO₄S

InChI: InChI=1S/C12H17NO4S/c1-3-4-9-13(2)18(16,17)11-7-5-10(6-8-11)12(14)15/h5-8H,3-4,9H2,1-2H3,(H,14,15)

InChI key: InChIKey=BAULKVQBIJAJSA-UHFFFAOYSA-N

SMILES: S(N(CCCC)C)(=O)(=O)C1=CC=C(C(O)=O)C=C1

Synonyms:

• 4-[(Butylmethylamino)sulfonyl]benzoic acid
• Benzoic acid, 4-[(butylmethylamino)sulfonyl]-
• IFLAB-BB F1386-0346
• 4-([BUTYL(METHYL)AMINO]SULFONYL)BENZOIC ACID
• 4-(N-butyl-N-methylsulfamoyl)benzoic acid

4-{[butyl(methyl)amino]sulfonyl}benzoic acid

CAS: 887202-44-0

Formula: C₁₂H₁₇NO₄S

Purity: 95.0%

Molecular weight: 271.33

Ref: 10-F369398