CymitQuimica logo

CAS 887235-00-9

:

4-Bromo-2-(1-pyrrolidinyl)benzaldehyde

Description:
4-Bromo-2-(1-pyrrolidinyl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a pyrrolidine ring attached to a benzaldehyde moiety. The presence of the bromine atom introduces both electrophilic and steric properties, influencing its reactivity and interactions in chemical reactions. The pyrrolidine group contributes to the compound's potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups, including the aldehyde, make it susceptible to oxidation and nucleophilic attack, which can be exploited in various synthetic applications. Additionally, the compound's structure suggests potential biological activity, making it of interest for research in drug discovery and development. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C11H12BrNO
InChI:InChI=1S/C11H12BrNO/c12-10-4-3-9(8-14)11(7-10)13-5-1-2-6-13/h3-4,7-8H,1-2,5-6H2
InChI key:InChIKey=UZVCTORVMMDVAN-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=C(Br)C=C1)N2CCCC2
Synonyms:
  • 4-Bromo-2-(pyrrolidin-1-yl)benzaldehyde
  • 4-Bromo-2-(1-pyrrolidinyl)benzaldehyde
  • Benzaldehyde, 4-bromo-2-(1-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.