CAS 887245-52-5

2H-Thiopyran-4-carboxylic acid, 4-aminotetrahydro-, methyl ester, 1,1-dioxide

Description:

2H-Thiopyran-4-carboxylic acid, 4-aminotetrahydro-, methyl ester, 1,1-dioxide, identified by CAS number 887245-52-5, is a chemical compound characterized by its unique thiopyran ring structure, which incorporates a sulfur atom within a six-membered ring. This compound features a carboxylic acid functional group and an amine group, contributing to its potential reactivity and biological activity. The presence of the methyl ester indicates that the carboxylic acid is esterified, which can influence its solubility and reactivity. The 1,1-dioxide designation suggests that the compound has two oxygen atoms bonded to the sulfur atom, enhancing its stability and potentially affecting its electronic properties. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the thiopyran structure may impart specific characteristics such as increased lipophilicity or altered metabolic pathways. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and biological applications.

Formula: C₇H₁₃NO₄S

InChI: InChI=1S/C7H13NO4S/c1-12-6(9)7(8)2-4-13(10,11)5-3-7/h2-5,8H2,1H3

InChI key: InChIKey=PRVCXEQAGFJWKX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(N)CCS(=O)(=O)CC1

Synonyms:

• 2H-Thiopyran-4-carboxylic acid, 4-aminotetrahydro-, methyl ester, 1,1-dioxide

Methyl 4-aminotetrahydro-2H-thiopyran-4-carboxylate 1,1-dioxide

CAS: 887245-52-5

Versatile small molecule scaffold

Formula: C₇H₁₃NO₄S

Purity: Min. 95%

Molecular weight: 207.25 g/mol

Ref: 3D-MKB24552