CAS 887247-29-2

3-Amino-5-(3-pyridinyl)-2-thiophenecarboxylic acid

Description:

3-Amino-5-(3-pyridinyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes an amino group, a thiophene ring, and a pyridine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry. The thiophene ring provides aromatic stability and can participate in various chemical reactions, while the pyridine ring adds to the compound's heterocyclic nature, influencing its solubility and reactivity. This compound may exhibit biological activity, potentially serving as a scaffold for drug development or as a ligand in coordination chemistry. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, 3-Amino-5-(3-pyridinyl)-2-thiophenecarboxylic acid represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₀H₈N₂O₂S

InChI: InChI=1S/C10H8N2O2S/c11-7-4-8(15-9(7)10(13)14)6-2-1-3-12-5-6/h1-5H,11H2,(H,13,14)

InChI key: InChIKey=KDQOMQMSVBAIFR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1SC(=CC1N)C=2C=CC=NC2

Synonyms:

• 2-Thiophenecarboxylic acid, 3-amino-5-(3-pyridinyl)-
• 3-Amino-5-(3-pyridinyl)-2-thiophenecarboxylic acid