CymitQuimica logo

CAS 887254-64-0

:

N-[1-(3-Bromophenyl)ethyl]acetamide

Description:
N-[1-(3-Bromophenyl)ethyl]acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of the 3-bromophenyl group indicates that the compound has a bromine atom attached to a phenyl ring, specifically at the meta position relative to the ethyl group. This substitution can influence the compound's reactivity and biological activity. The ethyl group contributes to the overall hydrophobic character of the molecule, while the amide linkage provides potential for hydrogen bonding, affecting solubility and interaction with biological targets. The compound may exhibit various properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, due to the presence of the bromine atom, it may exhibit unique electronic properties, making it of interest in medicinal chemistry and material science. Overall, N-[1-(3-Bromophenyl)ethyl]acetamide is a compound that combines aromatic and aliphatic characteristics, potentially leading to diverse applications in research and industry.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c1-7(12-8(2)13)9-4-3-5-10(11)6-9/h3-7H,1-2H3,(H,12,13)
InChI key:InChIKey=GHEDNSLOXLEUKX-UHFFFAOYSA-N
SMILES:C(NC(C)=O)(C)C1=CC(Br)=CC=C1
Synonyms:
  • Acetamide, N-[1-(3-bromophenyl)ethyl]-
  • N-[1-(3-Bromophenyl)ethyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.