CAS 887266-97-9

4-Fluoro-3-methoxybenzenesulfonyl chloride

Description:

4-Fluoro-3-methoxybenzenesulfonyl chloride, with the CAS number 887266-97-9, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a substituted aromatic ring. This compound features a fluorine atom and a methoxy group (-OCH3) on the benzene ring, which influence its reactivity and solubility. Typically, sulfonyl chlorides are known for their high reactivity, particularly in nucleophilic substitution reactions, making them valuable intermediates in organic synthesis. The presence of the fluorine atom can enhance the electrophilicity of the sulfonyl chloride, while the methoxy group may provide some steric hindrance and electronic effects that can modulate reactivity. This compound is likely to be a solid at room temperature and may be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. Overall, 4-Fluoro-3-methoxybenzenesulfonyl chloride is a useful reagent in the synthesis of pharmaceuticals and other complex organic molecules.

Formula: C₇H₆ClFO₃S

InChI: InChI=1S/C7H6ClFO3S/c1-12-7-4-5(13(8,10)11)2-3-6(7)9/h2-4H,1H3

InChI key: InChIKey=AJHUCNUEJYHKMR-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC(OC)=C(F)C=C1

Synonyms:

• 4-Fluoro-3-methoxybenzene-1-sulfonyl chloride
• Benzenesulfonyl chloride, 4-fluoro-3-methoxy-
• 4-Fluoro-3-methoxybenzenesulfonyl chloride

4-Fluoro-3-methoxybenzenesulphonyl chloride

CAS: 887266-97-9

4-Fluoro-3-methoxybenzenesulphonyl chloride

Formula: C₇H₆ClFO₃S

Purity: 95%

Color and Shape: pale yellow solid

Molecular weight: 224.64g/mol

Ref: 54-PC10594

4-Fluoro-3-methoxybenzenesulfonyl chloride

CAS: 887266-97-9

Formula: C₇H₆ClFO₃S

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 224.63

Ref: 10-F033071

4-Fluoro-3-methoxybenzenesulfonyl chloride

CAS: 887266-97-9

Versatile small molecule scaffold

Formula: C₇H₆ClFO₃S

Purity: Min. 95%

Molecular weight: 224.63 g/mol

Ref: 3D-MKB26697