CAS 887267-38-1

3-Chloro-2,4-difluorobenzonitrile

Description:

3-Chloro-2,4-difluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, two fluorine atoms, and a nitrile group (–C≡N). The presence of the chlorine and fluorine atoms introduces significant electronegativity, influencing the compound's reactivity and polarity. This compound typically appears as a solid at room temperature and is likely to be colorless to pale yellow. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to the presence of the nitrile functional group, which can participate in various chemical reactions. Additionally, the fluorine atoms can enhance the compound's stability and lipophilicity, making it suitable for specific applications in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Chloro-2,4-difluorobenzonitrile is a versatile compound with unique properties stemming from its halogen substitutions and nitrile functionality.

Formula: C₇H₂ClF₂N

InChI: InChI=1/C7H2ClF2N/c8-6-5(9)2-1-4(3-11)7(6)10/h1-2H

SMILES: c1cc(c(c(c1C#N)F)Cl)F

Synonyms:

• Benzonitrile, 3-Chloro-2,4-Difluoro-
• 3-Chloro-2,4-difluorobenzonitrile

3-Chloro-2,4-difluorobenzonitrile

CAS: 887267-38-1

Formula: C₇H₂ClF₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.5473

Ref: IN-DA004693

3-Chloro-2,4-difluorobenzonitrile

CAS: 887267-38-1

3-Chloro-2,4-difluorobenzonitrile

Purity: 98%

Molecular weight: 173.55g/mol

Ref: 54-PC1503

3-Chloro-2,4-difluorobenzonitrile

CAS: 887267-38-1

Formula: C₇H₂ClF₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.55

Ref: 10-F092065