CymitQuimica logo

CAS 887267-53-0

:

Benzenepropanoic acid,2,5-difluoro-b-oxo-,ethyl ester

Description:
Benzenepropanoic acid, 2,5-difluoro-b-oxo-, ethyl ester, identified by its CAS number 887267-53-0, is an organic compound characterized by its structure that includes a benzene ring, a propanoic acid moiety, and an ethyl ester functional group. The presence of two fluorine atoms at the 2 and 5 positions of the benzene ring contributes to its unique chemical properties, such as increased lipophilicity and potential reactivity in electrophilic substitution reactions. The ethyl ester group enhances its solubility in organic solvents and may influence its biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its synthesis typically involves the introduction of the fluorine substituents and the formation of the ester linkage, which can be achieved through various organic reactions. As with many fluorinated compounds, it may also display distinct environmental and toxicological profiles, necessitating careful handling and assessment in research and application contexts.
Formula:C11H10F2O3
InChI:InChI=1S/C11H10F2O3/c1-2-16-11(15)6-10(14)8-5-7(12)3-4-9(8)13/h3-5H,2,6H2,1H3
InChI key:FLBIFWLBLQKDAE-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(=O)C1=C(C=CC(=C1)F)F
Synonyms:
  • Ethyl2-(2,5-difluorobenzoyl)acetate
Found 4 products.