CAS 88728-27-2
:N-(diaminomethylidene)phenylalanine
Description:
N-(Diaminomethylidene)phenylalanine, also known by its CAS number 88728-27-2, is an amino acid derivative characterized by the presence of both an amino group and a phenylalanine backbone. This compound features a unique structure that includes a diaminomethylidene group, which contributes to its reactivity and potential applications in various fields, including biochemistry and pharmaceuticals. It is typically a white to off-white solid, soluble in water and polar organic solvents, which enhances its utility in biological systems. The presence of multiple amino groups allows for potential interactions with other biomolecules, making it of interest in peptide synthesis and drug design. Additionally, its structural properties may influence its ability to form hydrogen bonds and participate in enzymatic reactions. Overall, N-(diaminomethylidene)phenylalanine is a versatile compound with significant implications in research and development within the chemical and biological sciences.
Formula:C10H13N3O2
InChI:InChI=1/C10H13N3O2/c11-10(12)13-8(9(14)15)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,14,15)(H4,11,12,13)
SMILES:c1ccc(cc1)CC(C(=O)O)NC(=N)N
Synonyms:- N-(amino(imino)methyl)-3-phenyl--alanine
- N-(Aminoiminomethyl)phenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-((Diaminomethylene)amino)-3-phenylpropanoic Acid
CAS:Controlled ProductFormula:C10H13N3O2Color and Shape:NeatMolecular weight:207.229

