CymitQuimica logo

CAS 887308-15-8

:

5-Bromo-2-chloro-3-(methylthio)pyridine

Description:
5-Bromo-2-chloro-3-(methylthio)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine atom at the 5-position and a chlorine atom at the 2-position, contributing to its reactivity and potential applications in various chemical reactions. The presence of a methylthio group at the 3-position enhances its nucleophilicity and can influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry and agrochemicals due to their ability to interact with biological systems. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of halogens and a sulfur-containing group can impart unique properties, such as increased lipophilicity and potential for forming coordination complexes. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks.
Formula:C6H5BrClNS
InChI:InChI=1S/C6H5BrClNS/c1-10-5-2-4(7)3-9-6(5)8/h2-3H,1H3
InChI key:InChIKey=RXCNJXURGGQHOW-UHFFFAOYSA-N
SMILES:S(C)C1=C(Cl)N=CC(Br)=C1
Synonyms:
  • 5-Bromo-2-chloro-3-methylthiopyridine
  • Pyridine, 5-bromo-2-chloro-3-(methylthio)-
  • 5-Bromo-2-chloro-3-(methylthio)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.