CAS 88733-12-4

6-({3-[4-(4-hydroxy-2-methoxyphenyl)piperazin-1-yl]propyl}amino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione

Description:

The chemical substance known as "6-({3-[4-(4-hydroxy-2-methoxyphenyl)piperazin-1-yl]propyl}amino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione," with the CAS number 88733-12-4, is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine core substituted with various functional groups. This compound features a dimethylpyrimidine moiety, indicating the presence of two methyl groups attached to the pyrimidine ring, which contributes to its lipophilicity and potential biological activity. The presence of a piperazine ring suggests possible interactions with biological targets, particularly in the central nervous system. Additionally, the hydroxy and methoxy groups on the phenyl ring enhance its solubility and may influence its pharmacological properties. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and efficacy would depend on further studies, including pharmacokinetics and biological assays, to elucidate its mechanism of action and therapeutic potential.

Formula: C₂₀H₂₉N₅O₄

InChI: InChI=1/C20H29N5O4/c1-22-18(14-19(27)23(2)20(22)28)21-7-4-8-24-9-11-25(12-10-24)16-6-5-15(26)13-17(16)29-3/h5-6,13-14,21,26H,4,7-12H2,1-3H3

SMILES: Cn1c(cc(=O)n(C)c1=O)NCCCN1CCN(CC1)c1ccc(cc1OC)O

Synonyms:

• 6-((3-[4-(4-Hydroxy-2-methoxyphenyl)-1-piperazinyl]propyl)amino)-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
• 6-[3-[4-(2-Methoxy-4-hydroxyphenyl)piperazinyl]propylamino]-1,3-dimethyluracil

para-Hydroxy Urapidil

CAS: 88733-12-4

Formula: C₂₀H₂₉N₅O₄

Color and Shape: Pale Purple Solid

Molecular weight: 403.48

Ref: 4Z-U-079

p-Hydroxy Urapidil

CAS: 88733-12-4

Formula: C₂₀H₂₉N₅O₄

Molecular weight: 403.48

Ref: ST-EA-CP-U2012

4-Hydroxy Urapidil

Controlled Product

CAS: 88733-12-4

Formula: C₂₀H₂₉N₅O₄

Color and Shape: Neat

Molecular weight: 403.475

Ref: TR-H990950