
CAS 88733-57-7
:Carbamic acid, N,N-diethyl-, 2-aminophenyl ester
Description:
Carbamic acid, N,N-diethyl-, 2-aminophenyl ester, with the CAS number 88733-57-7, is an organic compound that belongs to the class of carbamates. This substance features a carbamic acid functional group, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N) that is further bonded to two ethyl groups. The compound also contains a 2-aminophenyl moiety, indicating that it has an amino group (-NH2) attached to a phenyl ring at the second position. This structure contributes to its potential biological activity and applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate solubility in organic solvents and may have specific reactivity patterns typical of carbamates, such as susceptibility to hydrolysis. Safety and handling precautions should be observed, as carbamates can exhibit toxicity and environmental persistence. Overall, the unique structural features of this compound may influence its chemical behavior and potential uses in synthetic chemistry and medicinal applications.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-3-13(4-2)11(14)15-10-8-6-5-7-9(10)12/h5-8H,3-4,12H2,1-2H3
InChI key:InChIKey=ORPXOZXUIVHWHB-UHFFFAOYSA-N
SMILES:O(C(N(CC)CC)=O)C1=C(N)C=CC=C1
Synonyms:- Carbamic acid, diethyl-, 2-aminophenyl ester
- 2-Aminophenyl N,N-diethylcarbamate
- 2-Aminophenyl diethylcarbamate
- Carbamic acid, N,N-diethyl-, 2-aminophenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
