CAS 887351-41-9

N-Cyclopropyl-2-nitro-4-(trifluoromethyl)benzenamine

Description:

N-Cyclopropyl-2-nitro-4-(trifluoromethyl)benzenamine is an organic compound characterized by its unique molecular structure, which includes a cyclopropyl group, a nitro group, and a trifluoromethyl group attached to a benzene ring. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro and trifluoromethyl substituents. The trifluoromethyl group often imparts increased lipophilicity and can enhance the compound's biological activity, making it of interest in pharmaceutical research. The nitro group can serve as a site for further chemical modifications or reactions. Additionally, the cyclopropyl moiety may influence the compound's conformational flexibility and steric properties. Overall, N-Cyclopropyl-2-nitro-4-(trifluoromethyl)benzenamine is a compound of interest in synthetic organic chemistry and medicinal chemistry, with potential applications in drug development and material science.

Formula: C₁₀H₉F₃N₂O₂

InChI: InChI=1S/C10H9F3N2O2/c11-10(12,13)6-1-4-8(14-7-2-3-7)9(5-6)15(16)17/h1,4-5,7,14H,2-3H2

InChI key: InChIKey=TVYYMXQIRKBFDY-UHFFFAOYSA-N

SMILES: N(C1=C(N(=O)=O)C=C(C(F)(F)F)C=C1)C2CC2

Synonyms:

• N-Cyclopropyl-2-nitro-4-(trifluoromethyl)aniline
• N-Cyclopropyl-2-nitro-4-(trifluoromethyl)benzenamine
• N-Cyclopropyl-2-nitro-4-trifluoromethylaniline
• Benzenamine, N-cyclopropyl-2-nitro-4-(trifluoromethyl)-

N-Cyclopropyl-2-nitro-4-trifluoromethylaniline

CAS: 887351-41-9

Formula: C₁₀H₉F₃N₂O₂

Molecular weight: 246.1859

Ref: IN-DA003SXO

N-Cyclopropyl-2-nitro-4-(trifluoromethyl)aniline

CAS: 887351-41-9

Formula: C₁₀H₉F₃N₂O₂

Purity: 95.0%

Molecular weight: 246.189

Ref: 10-F094056