CAS 887352-04-7
:N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-oxobutanamide
Description:
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-oxobutanamide, identified by its CAS number 887352-04-7, is a synthetic organic compound characterized by its complex structure, which includes a butanamide backbone with a ketone functional group and a substituted ethyl chain. The presence of the 3,4-dimethoxyphenyl group contributes to its aromatic properties, while the N-methyl substitution enhances its lipophilicity, potentially influencing its biological activity. This compound may exhibit various pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Additionally, the presence of methoxy groups can affect its electronic properties and interactions with biological targets. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential risks associated with its use. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C15H21NO4
InChI:InChI=1/C15H21NO4/c1-11(17)9-15(18)16(2)8-7-12-5-6-13(19-3)14(10-12)20-4/h5-6,10H,7-9H2,1-4H3
SMILES:CC(=O)CC(=O)N(C)CCc1ccc(c(c1)OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-ACETOACETYL-N-METHYL-2-(3,4-DIMETHOXYPHENYL)ETHYLAMINE
CAS:Formula:C15H21NO4Molecular weight:279.3315
