CAS 887352-07-0
:2-[4-(Acetyloxy)-2-methoxyphenoxy]acetonitrile
Description:
2-[4-(Acetyloxy)-2-methoxyphenoxy]acetonitrile, with the CAS number 887352-07-0, is an organic compound characterized by its complex structure that includes an acetyloxy group, a methoxy group, and a phenoxy moiety. This compound typically exhibits properties common to aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The acetyloxy group contributes to its reactivity, allowing for esterification and other transformations, while the methoxy group can influence its solubility and polarity. The presence of the acetonitrile group suggests potential applications in organic synthesis and as a building block in pharmaceuticals or agrochemicals. Its molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry. Overall, this compound's unique combination of functional groups and structural features positions it as a versatile intermediate in chemical synthesis and research.
Formula:C11H11NO4
InChI:InChI=1S/C11H11NO4/c1-8(13)16-9-3-4-10(15-6-5-12)11(7-9)14-2/h3-4,7H,6H2,1-2H3
InChI key:InChIKey=QWBMWQDSJOKPEV-UHFFFAOYSA-N
SMILES:O(C)C1=C(OCC#N)C=CC(OC(C)=O)=C1
Synonyms:- Acetonitrile, [4-(acetyloxy)-2-methoxyphenoxy]-
- 2-[4-(Acetyloxy)-2-methoxyphenoxy]acetonitrile
- Acetonitrile, 2-[4-(acetyloxy)-2-methoxyphenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-ACETOXY-2-METHOXYPHENOXY)-ACETONITRILE
CAS:Formula:C11H11NO4Color and Shape:SolidMolecular weight:221.2093
