CymitQuimica logo

CAS 887352-13-8

:

[2,2,5,5-tetramethyl-3-(methylsulfonyloxymethyl)pyrrol-1-yl] acetate

Description:
[2,2,5,5-tetramethyl-3-(methylsulfonyloxymethyl)pyrrol-1-yl] acetate, with the CAS number 887352-13-8, is a chemical compound characterized by its unique pyrrolidine structure, which features multiple methyl groups and a methylsulfonyloxymethyl substituent. This compound is likely to exhibit properties typical of pyrrolidine derivatives, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the acetate group suggests it may participate in esterification reactions or hydrolysis, while the methylsulfonyloxymethyl moiety could impart specific reactivity or biological activity. The steric hindrance introduced by the tetramethyl groups may influence its interaction with other molecules, potentially affecting its pharmacological properties if applicable. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and medicinal chemistry, although specific applications would depend on further research into its reactivity and biological effects.
Formula:C12H21NO5S
InChI:InChI=1/C12H21NO5S/c1-9(14)18-13-11(2,3)7-10(12(13,4)5)8-17-19(6,15)16/h7H,8H2,1-6H3
SMILES:CC(=O)ON1C(C)(C)C=C(COS(=O)(=O)C)C1(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.