CAS 887352-16-1

N-[4-Hydroxy-4-(3-pyridinyl)butyl]-N-methylacetamide

Description:

N-[4-Hydroxy-4-(3-pyridinyl)butyl]-N-methylacetamide, with the CAS number 887352-16-1, is a chemical compound characterized by its specific functional groups and structural features. It contains a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of a hydroxyl group (-OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The N-methylacetamide moiety suggests that it may exhibit amide characteristics, influencing its reactivity and interaction with other molecules. This compound is likely to be of interest in medicinal chemistry due to its structural components, which may confer specific pharmacological properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be assessed through various analytical methods. Overall, this compound's unique structure positions it as a potential candidate for further research in drug development or other chemical applications.

Formula: C₁₂H₁₈N₂O₂

InChI: InChI=1S/C12H18N2O2/c1-10(15)14(2)8-4-6-12(16)11-5-3-7-13-9-11/h3,5,7,9,12,16H,4,6,8H2,1-2H3

InChI key: InChIKey=WEPMTEZWTXZNJR-UHFFFAOYSA-N

SMILES: C(CCCN(C(C)=O)C)(O)C=1C=CC=NC1

Synonyms:

• Acetamide, N-[4-hydroxy-4-(3-pyridinyl)butyl]-N-methyl-
• N-[4-Hydroxy-4-(3-pyridinyl)butyl]-N-methylacetamide

4-(Acetylmethylamino)-1-(3-pyridyl)-1-butanol-d6

Controlled Product

CAS: 887352-16-1

Applications 4-(Acetylmethylamino)-1-(3-pyridyl)-1-butanol-d6 (cas# 887352-16-1) is a compound useful in organic synthesis.

Formula: C₁₂H₁₂D₆N₂O₂

Color and Shape: Neat

Molecular weight: 222.28

Ref: TR-A186562

4-(Acetylmethylamino)-1-(3-pyridyl)-1-butanol

Controlled Product

CAS: 887352-16-1

Applications 4-(Acetylmethylamino)-1-(3-pyridyl)-1-butanol (cas# 887352-16-1) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₂H₁₈N₂O₂

Color and Shape: Neat

Molecular weight: 222.28

Ref: TR-A186560