CymitQuimica logo

CAS 887352-19-4

:

1-[4-(4-Methylbenzoyl)-1-piperidinyl]ethanone

Description:
1-[4-(4-Methylbenzoyl)-1-piperidinyl]ethanone, identified by its CAS number 887352-19-4, is a chemical compound that features a piperidine ring substituted with a ketone and a benzoyl group. This compound typically exhibits characteristics common to piperidine derivatives, including potential biological activity due to its structural motifs. The presence of the 4-methylbenzoyl group suggests that it may have aromatic properties, which can influence its solubility and reactivity. The ketone functional group contributes to its reactivity, making it a candidate for various chemical reactions, such as nucleophilic additions. In terms of physical properties, compounds of this nature may be solid or liquid at room temperature, depending on their molecular weight and structure. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C15H19NO2
InChI:InChI=1S/C15H19NO2/c1-11-3-5-13(6-4-11)15(18)14-7-9-16(10-8-14)12(2)17/h3-6,14H,7-10H2,1-2H3
InChI key:InChIKey=PKWJZPGTKVWEBH-UHFFFAOYSA-N
SMILES:C(=O)(C1CCN(C(C)=O)CC1)C2=CC=C(C)C=C2
Synonyms:
  • 1-[4-(4-Methylbenzoyl)-1-piperidinyl]ethanone
  • 1-[4-(4-Methylbenzoyl)piperidin-1-yl]ethan-1-one
  • Ethanone, 1-[4-(4-methylbenzoyl)-1-piperidinyl]-
  • Piperidine, 1-acetyl-4-(4-methylbenzoyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.