CymitQuimica logo

CAS 887352-34-3

:

5-amino-6-bromopyrazine-2-carboxylic acid

Description:
5-Amino-6-bromopyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its reactivity and solubility in polar solvents. The bromine atom at the 6-position of the pyrazine ring introduces a halogen substituent, which can influence the compound's electronic properties and reactivity. The presence of both the amino and carboxylic acid functional groups makes this compound a potential candidate for various chemical reactions, including coupling reactions and as a building block in the synthesis of more complex molecules. Additionally, its structural features may impart biological activity, making it of interest in pharmaceutical research. Overall, 5-amino-6-bromopyrazine-2-carboxylic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C5H4BrN3O2
InChI:InChI=1/C5H4BrN3O2/c6-3-4(7)8-1-2(9-3)5(10)11/h1H,(H2,7,8)(H,10,11)
InChI key:ZWJHDIXBWPBYGD-UHFFFAOYSA-N
SMILES:c1c(C(=O)O)nc(c(N)n1)Br
Synonyms:
  • 2-Pyrazinecarboxylic Acid, 5-Amino-6-Bromo-
Found 4 products.