CymitQuimica logo

CAS 887352-37-6

:

6-chloro-3-hydroxy-2-imino-1,4-dihydropyrimidin-4-amine

Description:
6-Chloro-3-hydroxy-2-imino-1,4-dihydropyrimidin-4-amine is a chemical compound that belongs to the class of dihydropyrimidines, which are characterized by a six-membered ring containing nitrogen atoms. This particular compound features a chloro substituent at the 6-position and a hydroxy group at the 3-position, contributing to its unique reactivity and potential biological activity. The presence of the imino group at the 2-position and the amino group at the 4-position further enhances its chemical properties, making it a candidate for various applications in medicinal chemistry. The compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further empirical studies. Its molecular structure suggests it could participate in hydrogen bonding and other interactions, influencing its solubility and stability in different solvents. As with many nitrogen-containing heterocycles, it may also be involved in various synthetic pathways, making it of interest in organic synthesis and pharmaceutical development.
Formula:C4H7ClN4O
InChI:InChI=1/C4H7ClN4O/c5-2-1-3(6)9(10)4(7)8-2/h1,3,10H,6H2,(H2,7,8)
SMILES:C1=C(Cl)NC(=N)N(C1N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.