CAS 887352-57-0
:ethyl 2-amino-4,5,7,8-tetrahydrothiazolo[4,5-d]azepine-6-carboxylate
Description:
Ethyl 2-amino-4,5,7,8-tetrahydrothiazolo[4,5-d]azepine-6-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a thiazole and azepine moiety. This compound features an ethyl ester functional group, contributing to its solubility properties and potential reactivity. The presence of an amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The tetrahydrothiazolo structure indicates that it is a saturated derivative, which may influence its biological activity and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and effects would depend on the functional groups and the overall molecular conformation. As with many organic compounds, its behavior in biological systems, including absorption, distribution, metabolism, and excretion (ADME), would be critical for understanding its potential applications. Further studies would be necessary to elucidate its full chemical and biological profile.
Formula:C10H15N3O2S
InChI:InChI=1/C10H15N3O2S/c1-2-15-10(14)13-5-3-7-8(4-6-13)16-9(11)12-7/h2-6H2,1H3,(H2,11,12)
SMILES:CCOC(=O)N1CCc2c(CC1)sc(=N)[nH]2
Synonyms:- 2-AMino-4,5,7,8-tetrahydro-6H-thiazolo[4,5-d]azepine-6-carboxylic Acid Ethyl Ester
- 2-AMINO-4,5,7,8-TETRAHYDRO-6-(N-CARBETHOXY)THIAZOLO[5,4-D]AZEPINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-4,5,7,8-tetrahydro-6-(N-carbethoxy)thiazolo[5,4-d]azepine
CAS:Controlled ProductApplications 2-Amino-4,5,7,8-tetrahydro-6-(N-carbethoxy)thiazolo[5,4-d]azepine (cas# 887352-57-0) is a compound useful in organic synthesis.
Formula:C10H15N3O2SColor and Shape:NeatMolecular weight:241.31
