CymitQuimica logo

CAS 887352-60-5

:

ethyl 2-amino-4,6,7,8-tetrahydrothiazolo[5,4-c]azepine-5-carboxylate

Description:
Ethyl 2-amino-4,6,7,8-tetrahydrothiazolo[5,4-c]azepine-5-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a thiazole and azepine moiety. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group indicates potential for hydrogen bonding and reactivity in various chemical reactions, making it a candidate for further functionalization. The tetrahydrothiazolo structure suggests that it may exhibit unique biological activities, potentially making it of interest in medicinal chemistry. Its molecular framework may allow for interactions with biological targets, which could be explored in drug development. The compound's CAS number, 887352-60-5, serves as a unique identifier for regulatory and research purposes. Overall, this compound's structural features suggest it may possess interesting chemical and biological properties, warranting further investigation in various fields, including pharmaceuticals and organic synthesis.
Formula:C10H15N3O2S
InChI:InChI=1/C10H15N3O2S/c1-2-15-10(14)13-5-3-4-7-8(6-13)16-9(11)12-7/h2-6H2,1H3,(H2,11,12)
SMILES:CCOC(=O)N1CCCc2c(C1)sc(=N)[nH]2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.