CymitQuimica logo

CAS 887352-65-0

:

S-[2-({[4-(phenylcarbonyl)phenyl]carbonyl}amino)ethyl] methanesulfonothioate

Description:
S-[2-({[4-(phenylcarbonyl)phenyl]carbonyl}amino)ethyl] methanesulfonothioate is a synthetic organic compound characterized by its complex structure, which includes a methanesulfonothioate group and a phenylcarbonyl moiety. This compound features a sulfonothioate functional group, which is known for its potential reactivity and ability to participate in nucleophilic substitution reactions. The presence of the phenylcarbonyl groups suggests that it may exhibit significant aromatic character, potentially influencing its solubility and reactivity. Additionally, the aminoethyl linkage indicates that it may have biological activity, possibly interacting with biological targets due to the presence of the amino group. The compound's unique structure may also confer specific properties such as stability under certain conditions, while its sulfonothioate group could impart distinct chemical behavior in various environments. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and materials science, where its reactivity and structural features could be leveraged for various applications.
Formula:C17H17NO4S2
InChI:InChI=1/C17H17NO4S2/c1-24(21,22)23-12-11-18-17(20)15-9-7-14(8-10-15)16(19)13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H,18,20)
SMILES:CS(=O)(=O)SCCNC(=O)c1ccc(cc1)C(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.