CymitQuimica logo

CAS 887352-68-3

:

2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-({[4-(phenylcarbonyl)phenyl]carbonyl}amino)propanoic acid

Description:
The chemical substance known as 2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-({[4-(phenylcarbonyl)phenyl]carbonyl}amino)propanoic acid, with the CAS number 887352-68-3, is a complex organic compound characterized by its multi-functional groups. It features a pyrrole ring with two carbonyl groups, indicating potential reactivity and stability under certain conditions. The presence of an amino group suggests that it can participate in various chemical reactions, including peptide bond formation. The compound also contains a propanoic acid moiety, which contributes to its acidity and potential for forming salts. Additionally, the phenylcarbonyl groups indicate that the molecule may exhibit significant aromatic character, which can influence its solubility and interaction with other substances. Overall, this compound's structure suggests potential applications in pharmaceuticals or materials science, particularly due to its unique combination of functional groups that may facilitate specific biological or chemical interactions. Further studies would be necessary to explore its properties and potential uses in various fields.
Formula:C21H16N2O6
InChI:InChI=1/C21H16N2O6/c24-17-10-11-18(25)23(17)16(21(28)29)12-22-20(27)15-8-6-14(7-9-15)19(26)13-4-2-1-3-5-13/h1-11,16H,12H2,(H,22,27)(H,28,29)
SMILES:c1ccc(cc1)C(=O)c1ccc(cc1)C(=O)NCC(C(=O)O)N1C(=O)C=CC1=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.