CAS 887352-80-9
:benzyl 3-(dibenzylamino)-2-fluoro-propanoate
Description:
Benzyl 3-(dibenzylamino)-2-fluoro-propanoate is a chemical compound characterized by its unique structure, which includes a benzyl group, a dibenzylamino moiety, and a fluoro-substituted propanoate. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry and organic synthesis. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, making it of interest in drug development. Additionally, the dibenzylamino group may impart specific electronic and steric effects, which can affect the compound's reactivity and interaction with biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory settings. Overall, benzyl 3-(dibenzylamino)-2-fluoro-propanoate represents a complex organic molecule with potential utility in various chemical and pharmaceutical applications.
Formula:C24H24FNO2
InChI:InChI=1/C24H24FNO2/c25-23(24(27)28-19-22-14-8-3-9-15-22)18-26(16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21/h1-15,23H,16-19H2
SMILES:c1ccc(cc1)CN(Cc1ccccc1)CC(C(=O)OCc1ccccc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
