CAS 887352-83-2
:benzyl 5-[(dicyclohexylcarbamimidoyl)oxy]-5-oxopentanoate
Description:
Benzyl 5-[(dicyclohexylcarbamimidoyl)oxy]-5-oxopentanoate, with the CAS number 887352-83-2, is a chemical compound characterized by its complex structure, which includes a benzyl group, a pentanoate moiety, and a dicyclohexylcarbamimidoyl functional group. This compound typically exhibits properties associated with esters, such as being relatively non-volatile and having moderate solubility in organic solvents. The presence of the carbamimidoyl group suggests potential reactivity, particularly in forming hydrogen bonds or participating in nucleophilic reactions. Its molecular structure may confer specific biological activities, making it of interest in medicinal chemistry or as a potential pharmaceutical intermediate. Additionally, the dicyclohexylcarbamimidoyl group may enhance lipophilicity, influencing its interaction with biological membranes. Overall, this compound's unique combination of functional groups and structural features positions it as a potentially valuable substance in various chemical applications, including drug development and synthesis.
Formula:C25H36N2O4
InChI:InChI=1/C25H36N2O4/c28-23(30-19-20-11-4-1-5-12-20)17-10-18-24(29)31-25(26-21-13-6-2-7-14-21)27-22-15-8-3-9-16-22/h1,4-5,11-12,21-22H,2-3,6-10,13-19H2,(H,26,27)
SMILES:c1ccc(cc1)COC(=O)CCCC(=O)OC(=NC1CCCCC1)NC1CCCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Benzyl-5-(dicyclohexylcarbodiimido)glutarate
CAS:Formula:C25H36N2O4Color and Shape:SolidMolecular weight:428.56431-Benzyl-5-(dicyclohexylcarbodiimido)glutarate
CAS:Controlled ProductApplications 1-Benzyl-5-(dicyclohexylcarbodiimido)glutarate (cas# 887352-83-2) is a compound useful in organic synthesis.
Formula:C25H36N2O4Color and Shape:NeatMolecular weight:428.56

