CAS 887352-92-3
:N-[3-Mercapto-4-(phenylmethoxy)phenyl]acetamide
Description:
N-[3-Mercapto-4-(phenylmethoxy)phenyl]acetamide, with the CAS number 887352-92-3, is a chemical compound characterized by the presence of a mercapto group (-SH) and an acetamide functional group. This compound features a phenylmethoxy substituent, which contributes to its potential applications in medicinal chemistry and organic synthesis. The mercapto group imparts thiol characteristics, making it reactive in various chemical reactions, such as disulfide bond formation or nucleophilic substitutions. The presence of the acetamide group suggests potential for hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the phenylmethoxy moiety may enhance lipophilicity, affecting the compound's pharmacokinetic properties. Overall, this compound's unique structural features may provide avenues for research in drug development, particularly in the context of targeting specific biological pathways or as a building block in the synthesis of more complex molecules.
Formula:C15H15NO2S
InChI:InChI=1S/C15H15NO2S/c1-11(17)16-13-7-8-14(15(19)9-13)18-10-12-5-3-2-4-6-12/h2-9,19H,10H2,1H3,(H,16,17)
InChI key:InChIKey=RAEVGIDMILXZIH-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(S)=C(OCC2=CC=CC=C2)C=C1
Synonyms:- N-[3-Mercapto-4-(phenylmethoxy)phenyl]-acetamide
- Acetamide, N-[3-mercapto-4-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetamide,N-[3-mercapto-4-(phenylmethoxy)phenyl]-
CAS:Formula:C15H15NO2SColor and Shape:SolidMolecular weight:273.3501
