CymitQuimica logo

CAS 887352-95-6

:

1-({2-[4-(benzyloxy)-2-methoxyphenoxy]ethyl}amino)-3-(9H-carbazol-4-yloxy)propan-2-ol

Description:
1-({2-[4-(benzyloxy)-2-methoxyphenoxy]ethyl}amino)-3-(9H-carbazol-4-yloxy)propan-2-ol, with the CAS number 887352-95-6, is a complex organic compound characterized by its multi-functional structure. It features a carbazole moiety, which is known for its aromatic properties and potential applications in organic electronics and photonics. The presence of a benzyloxy and methoxy group suggests enhanced solubility and potential interactions with biological systems, making it of interest in medicinal chemistry. The compound also contains an amino group, which can participate in hydrogen bonding and may influence its pharmacological properties. Its propanol backbone indicates the presence of hydroxyl functionality, contributing to its reactivity and potential as a ligand in various chemical reactions. Overall, this compound's unique structural features may confer specific biological activities, warranting further investigation in drug development and related fields.
Formula:C31H32N2O5
InChI:InChI=1/C31H32N2O5/c1-35-30-18-24(37-20-22-8-3-2-4-9-22)14-15-28(30)36-17-16-32-19-23(34)21-38-29-13-7-12-27-31(29)25-10-5-6-11-26(25)33-27/h2-15,18,23,32-34H,16-17,19-21H2,1H3
SMILES:COc1cc(ccc1OCCNCC(COc1cccc2c1c1ccccc1[nH]2)O)OCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.