CymitQuimica logo

CAS 887353-00-6

:

1-({2-[5-(benzyloxy)-2-methoxyphenoxy]ethyl}amino)-3-(9H-carbazol-4-yloxy)propan-2-ol

Description:
The chemical substance known as 1-({2-[5-(benzyloxy)-2-methoxyphenoxy]ethyl}amino)-3-(9H-carbazol-4-yloxy)propan-2-ol, with the CAS number 887353-00-6, is a complex organic compound characterized by its multi-functional structure. It features a propanol backbone with an amino group, which contributes to its potential as a pharmacological agent. The presence of a carbazole moiety suggests possible applications in organic electronics or as a fluorescent material, while the benzyloxy and methoxy groups may enhance its solubility and biological activity. This compound is likely to exhibit interesting interactions due to its diverse functional groups, making it a candidate for research in medicinal chemistry, particularly in the development of therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties, such as solubility, stability, and reactivity, would be influenced by the arrangement of its substituents. Further studies would be necessary to elucidate its biological activity and potential applications in various fields.
Formula:C31H32N2O5
InChI:InChI=1/C31H32N2O5/c1-35-28-15-14-24(37-20-22-8-3-2-4-9-22)18-30(28)36-17-16-32-19-23(34)21-38-29-13-7-12-27-31(29)25-10-5-6-11-26(25)33-27/h2-15,18,23,32-34H,16-17,19-21H2,1H3
SMILES:COc1ccc(cc1OCCNCC(COc1cccc2c1c1ccccc1[nH]2)O)OCc1ccccc1
Synonyms:
  • 1-(9H-Carbazol-4-yloxy)-3-[[2-[2-methoxy-5-(phenylmethoxy)phenoxy]ethyl]amino]-2-propanol
  • 5'-BENZYLOXY-CARVEDILOL
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.