CAS 887353-08-4

2-[2-Methoxy-5-(phenylmethoxy)phenoxy]ethanamine

Description:

2-[2-Methoxy-5-(phenylmethoxy)phenoxy]ethanamine, with the CAS number 887353-08-4, is an organic compound characterized by its complex structure, which includes multiple aromatic rings and ether functionalities. This compound features a phenoxy group, which contributes to its potential as a ligand in various chemical reactions. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The ethanamine moiety suggests that it may exhibit basic properties, allowing it to participate in acid-base reactions. Additionally, the compound's structural features may impart specific pharmacological activities, making it of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its purity and structural integrity. Overall, this compound's unique characteristics make it a subject of interest in both research and potential applications in pharmaceuticals or materials science.

Formula: C₁₆H₁₉NO₃

InChI: InChI=1S/C16H19NO3/c1-18-15-8-7-14(11-16(15)19-10-9-17)20-12-13-5-3-2-4-6-13/h2-8,11H,9-10,12,17H2,1H3

InChI key: InChIKey=DXEHYTPISKQBCT-UHFFFAOYSA-N

SMILES: O(CCN)C1=C(OC)C=CC(OCC2=CC=CC=C2)=C1

Synonyms:

• Ethanamine, 2-[2-methoxy-5-(phenylmethoxy)phenoxy]-
• 2-[2-Methoxy-5-(phenylmethoxy)phenoxy]ethanamine