CymitQuimica logo

CAS 887353-18-6

:

diprop-2-en-1-yl (9-oxo-9,10-dihydroacridine-3,6-diyl)biscarbamate

Description:
Diprop-2-en-1-yl (9-oxo-9,10-dihydroacridine-3,6-diyl)biscarbamate is a synthetic organic compound characterized by its unique structure, which includes an acridine moiety and two carbamate functional groups. The presence of the diprop-2-en-1-yl group suggests that it has unsaturation, which may contribute to its reactivity and potential applications in polymer chemistry or as a building block in organic synthesis. The acridine structure is known for its biological activity, including potential antitumor properties, while the carbamate groups can enhance solubility and stability. This compound may exhibit interesting physicochemical properties such as moderate to high melting points and solubility in organic solvents, making it suitable for various applications in medicinal chemistry and materials science. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C21H19N3O5
InChI:InChI=1/C21H19N3O5/c1-3-9-28-20(26)22-13-5-7-15-17(11-13)24-18-12-14(6-8-16(18)19(15)25)23-21(27)29-10-4-2/h3-8,11-12H,1-2,9-10H2,(H,22,26)(H,23,27)(H,24,25)
SMILES:C=CCOC(=Nc1ccc2c(c1)[nH]c1cc(ccc1c2=O)N=C(O)OCC=C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.