CAS 887353-38-0

C-(1,1-Dimethylethyl) C′-[4-(hydroxymethyl)phenyl] dicarbonate

Description:

C-(1,1-Dimethylethyl) C′-[4-(hydroxymethyl)phenyl] dicarbonate, identified by its CAS number 887353-38-0, is an organic compound characterized by its dicarbonate functional groups. This substance features a tert-butyl group (1,1-dimethylethyl) and a hydroxymethyl-substituted phenyl moiety, which contribute to its chemical reactivity and potential applications. The presence of dicarbonate groups suggests that it may be involved in esterification reactions, making it useful in polymer chemistry, particularly in the synthesis of polycarbonate materials. The hydroxymethyl group can enhance solubility and reactivity, allowing for further functionalization. This compound is likely to exhibit moderate stability under standard conditions but may decompose or react under extreme temperatures or in the presence of strong acids or bases. Its unique structure may also impart specific properties such as UV stability or enhanced mechanical strength in polymer matrices. Overall, this compound's characteristics make it a candidate for various industrial applications, particularly in materials science and organic synthesis.

Formula: C₁₃H₁₆O₆

InChI: InChI=1S/C13H16O6/c1-13(2,3)19-12(16)18-11(15)17-10-6-4-9(8-14)5-7-10/h4-7,14H,8H2,1-3H3

InChI key: InChIKey=DKZUUZFITNQYGJ-UHFFFAOYSA-N

SMILES: O(C(OC(OC(C)(C)C)=O)=O)C1=CC=C(CO)C=C1

Synonyms:

• Dicarbonic acid, C-(1,1-dimethylethyl) C′-[4-(hydroxymethyl)phenyl] ester
• C-(1,1-Dimethylethyl) C′-[4-(hydroxymethyl)phenyl] dicarbonate