CAS 887353-52-8
:Carbamic acid, ethyl(4-oxopentyl)-, 1,1-dimethylethyl ester
Description:
Carbamic acid, ethyl(4-oxopentyl)-, 1,1-dimethylethyl ester, identified by CAS number 887353-52-8, is an organic compound characterized by its carbamate functional group. This substance features a carbamic acid moiety linked to an ethyl group and a 1,1-dimethylethyl ester, which contributes to its unique structural properties. The presence of the 4-oxopentyl group indicates that it contains a ketone functional group, which can influence its reactivity and interactions with other chemical species. Typically, compounds of this nature may exhibit moderate solubility in organic solvents and may be less soluble in water due to their hydrophobic characteristics. The ester functionality suggests that it could undergo hydrolysis under certain conditions, releasing the corresponding alcohol and carbamic acid. Additionally, the compound may have applications in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C12H23NO3
InChI:InChI=1S/C12H23NO3/c1-6-13(9-7-8-10(2)14)11(15)16-12(3,4)5/h6-9H2,1-5H3
InChI key:InChIKey=FCDKSCSEAZAHMP-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(CCCC(C)=O)CC
Synonyms:- Carbamic acid, ethyl(4-oxopentyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(t-Boc)-N-ethyl-4-oxopentylamine
CAS:Formula:C12H23NO3Color and Shape:LiquidMolecular weight:229.3159
