CAS 887353-92-6

6-(3-hydroxy-N-methyl-anilino)hexanoic acid

Description:

6-(3-Hydroxy-N-methyl-anilino)hexanoic acid, identified by its CAS number 887353-92-6, is an organic compound characterized by its structure, which includes a hexanoic acid backbone with a substituted aniline group. This compound features a hydroxyl group and a methylated nitrogen atom within the aniline moiety, contributing to its potential solubility in polar solvents. The presence of both hydrophobic (hexanoic acid chain) and hydrophilic (hydroxyl and amine groups) characteristics suggests that it may exhibit amphiphilic properties, making it useful in various applications, including pharmaceuticals and materials science. Its molecular structure allows for potential interactions such as hydrogen bonding, which can influence its reactivity and stability. Additionally, the compound may exhibit biological activity due to the aniline derivative, which is often associated with various pharmacological effects. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₃H₁₉NO₃

InChI: InChI=1/C13H19NO3/c1-14(9-4-2-3-8-13(16)17)11-6-5-7-12(15)10-11/h5-7,10,15H,2-4,8-9H2,1H3,(H,16,17)

SMILES: CN(CCCCCC(=O)O)c1cccc(c1)O

N-(5-Carboxypentyl)-3-hydroxy-N-methylaniline

Controlled Product

CAS: 887353-92-6

Formula: C₁₃H₁₉NO₃

Color and Shape: Neat

Molecular weight: 237.29

Ref: TR-C181210