CAS 887354-13-4
:2-chloro-1,5,6-trimethyl-1H-imidazo[4,5-b]pyridine
Description:
2-Chloro-1,5,6-trimethyl-1H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. The presence of three methyl groups at the 1, 5, and 6 positions, along with a chlorine substituent at the 2 position, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The chlorine atom can influence the compound's electronic properties and reactivity, potentially enhancing its interactions with biological targets. Additionally, the imidazo[4,5-b]pyridine framework is known for its presence in various pharmacologically active compounds, which may suggest similar applications for this substance. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C9H10ClN3
InChI:InChI=1/C9H10ClN3/c1-5-4-7-8(11-6(5)2)12-9(10)13(7)3/h4H,1-3H3
SMILES:Cc1cc2c(nc1C)nc(Cl)n2C
Synonyms:- 2-CHLORO-1,5,6-TRIMETHYLIMIDAZO [4,5-B] PYRIDINE
- 2-Chloro-1,5,6-triMethyl-1H-iMidazo[4,5-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chloro-1,5,6-trimethylimidazo [4,5-b] Pyridine
CAS:Formula:C9H10ClN3Color and Shape:SolidMolecular weight:195.6488
