CAS 887354-22-5

5-(dimethylamino)-N-{2-[(3-hydrazino-3-oxopropyl)disulfanyl]ethyl}naphthalene-1-sulfonamide

Description:

5-(Dimethylamino)-N-{2-[(3-hydrazino-3-oxopropyl)disulfanyl]ethyl}naphthalene-1-sulfonamide, with CAS number 887354-22-5, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene ring, a sulfonamide group, and a hydrazino moiety. The presence of the dimethylamino group suggests it may exhibit basic properties, potentially influencing its solubility and reactivity. The disulfide linkage in the molecule indicates potential for redox activity, which could be relevant in biological systems or in the development of pharmaceuticals. This compound may also possess biological activity due to the hydrazine component, which is often associated with various pharmacological effects. Its sulfonamide group is known for its antibacterial properties, suggesting potential applications in medicinal chemistry. Overall, the unique combination of functional groups in this compound may lead to interesting chemical behavior and biological interactions, making it a subject of interest in research and development within the fields of medicinal and organic chemistry.

Formula: C₁₇H₂₄N₄O₃S₃

InChI: InChI=1/C17H24N4O3S3/c1-21(2)15-7-3-6-14-13(15)5-4-8-16(14)27(23,24)19-10-12-26-25-11-9-17(22)20-18/h3-8,19H,9-12,18H2,1-2H3,(H,20,22)

SMILES: CN(C)c1cccc2c1cccc2S(=O)(=O)NCCSSCCC(=NN)O

2-(Dansylsulfonamido)ethyl-3-(hydrazinocarboxy)ethyl Disulfide

CAS: 887354-22-5

Formula: C₁₇H₂₄N₄O₃S₃

Molecular weight: 428.5925

Ref: IN-DA00466D