CAS 887354-43-0
:2,6-Bis(bromomethyl)-9,10-dichloroanthracene
Description:
2,6-Bis(bromomethyl)-9,10-dichloroanthracene is a polycyclic aromatic hydrocarbon characterized by its complex structure, which includes multiple halogen substituents. This compound features two bromomethyl groups at the 2 and 6 positions and dichloro substituents at the 9 and 10 positions of the anthracene backbone. The presence of these halogen atoms significantly influences its chemical reactivity, solubility, and potential applications in organic synthesis and materials science. Typically, such compounds exhibit strong fluorescence properties, making them of interest in photonic applications. Additionally, the bromomethyl groups can serve as reactive sites for further chemical modifications, allowing for the synthesis of more complex derivatives. The compound's stability and reactivity can be affected by the electronic effects of the halogen substituents, which can also impact its interactions with biological systems. Overall, 2,6-Bis(bromomethyl)-9,10-dichloroanthracene is a notable compound in the field of organic chemistry, particularly in studies related to halogenated aromatic compounds.
Formula:C16H10Br2Cl2
InChI:InChI=1S/C16H10Br2Cl2/c17-7-9-1-3-11-13(5-9)16(20)12-4-2-10(8-18)6-14(12)15(11)19/h1-6H,7-8H2
InChI key:InChIKey=GSTSDRRGFXXPHF-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(Cl)=C3C1C=CC(CBr)=C3)C=CC(CBr)=C2
Synonyms:- Anthracene, 2,6-bis(bromomethyl)-9,10-dichloro-
- 2,6-Bis(bromomethyl)-9,10-dichloroanthracene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9,10-Dichloro-2,6-bis(bromomethyl)anthracene
CAS:Controlled ProductApplications 9,10-Dichloro-2,6-bis(bromomethyl)anthracene (cas# 887354-43-0) is a compound useful in organic synthesis.
Formula:C16H10Br2Cl2Color and Shape:NeatMolecular weight:432.96
