CAS 887354-46-3
:9,10-Dichloro-2,6-dimethylanthracene
Description:
9,10-Dichloro-2,6-dimethylanthracene is an organic compound belonging to the anthracene family, characterized by its polycyclic aromatic structure. This substance features two chlorine atoms substituted at the 9 and 10 positions and two methyl groups at the 2 and 6 positions of the anthracene backbone. It is typically a solid at room temperature and exhibits a high degree of stability due to its conjugated π-electron system, which contributes to its potential applications in organic electronics and photonics. The presence of chlorine and methyl groups can influence its solubility, reactivity, and electronic properties, making it of interest in various chemical research fields. Additionally, its unique structure may impart specific optical properties, which can be harnessed in dye applications or as a fluorescent probe. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 9,10-Dichloro-2,6-dimethylanthracene represents a significant compound for studies in organic synthesis and materials science.
Formula:C16H12Cl2
InChI:InChI=1S/C16H12Cl2/c1-9-3-5-11-13(7-9)15(17)12-6-4-10(2)8-14(12)16(11)18/h3-8H,1-2H3
InChI key:InChIKey=MSPFHAUJGCSBSJ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(Cl)=C3C1C=C(C)C=C3)C=C(C)C=C2
Synonyms:- 9,10-Dichloro-2,6-dimethylanthracene
- Anthracene, 9,10-dichloro-2,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Anthracene,9,10-dichloro-2,6-dimethyl-
CAS:Formula:C16H12Cl2Color and Shape:SolidMolecular weight:275.17259,10-Dichloro-2,6-dimethylanthracene
CAS:Controlled ProductApplications 9,10-Dichloro-2,6-dimethylanthracene (cas# 887354-46-3) is a compound useful in organic synthesis.
Formula:C16H12Cl2Color and Shape:NeatMolecular weight:275.17


