CymitQuimica logo

CAS 887354-51-0

:

Ethyl 3-[(diethoxyphosphinyl)oxy]-7,11,15-trimethyl-2,6,10,14-hexadecatetraenoate

Description:
Ethyl 3-[(diethoxyphosphinyl)oxy]-7,11,15-trimethyl-2,6,10,14-hexadecatetraenoate is a chemical compound characterized by its complex structure, which includes a phosphinyl group and a long hydrocarbon chain with multiple double bonds. This compound belongs to the class of organophosphorus compounds, which are known for their diverse applications, including in agriculture as pesticides and herbicides. The presence of the diethoxyphosphinyl group suggests potential reactivity and biological activity, making it of interest in medicinal chemistry and agrochemical research. The ethyl ester functional group indicates that it may exhibit solubility in organic solvents, which can influence its application and behavior in various environments. Additionally, the multiple double bonds in the hydrocarbon chain contribute to its reactivity and potential for undergoing various chemical transformations. Overall, this compound's unique structural features may lead to specific interactions in biological systems, warranting further investigation into its properties and potential uses.
Formula:C25H43O6P
InChI:InChI=1S/C25H43O6P/c1-8-28-25(26)20-24(31-32(27,29-9-2)30-10-3)19-13-18-23(7)17-12-16-22(6)15-11-14-21(4)5/h14,16,18,20H,8-13,15,17,19H2,1-7H3
InChI key:InChIKey=NUGFSECZJBXADK-UHFFFAOYSA-N
SMILES:O(C(CCC=C(CCC=C(CCC=C(C)C)C)C)=CC(OCC)=O)P(OCC)(OCC)=O
Synonyms:
  • 2,6,10,14-Hexadecatetraenoic acid, 3-[(diethoxyphosphinyl)oxy]-7,11,15-trimethyl-, ethyl ester
  • Ethyl 3-[(diethoxyphosphinyl)oxy]-7,11,15-trimethyl-2,6,10,14-hexadecatetraenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.