CymitQuimica logo

CAS 887354-80-5

:

2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid

Description:
2,2-Dimethyl-3-(4-sulfanylphenyl)propanoic acid is an organic compound characterized by its unique structure, which includes a propanoic acid backbone with two methyl groups and a phenyl group substituted with a sulfanyl (thiol) functional group. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity due to the presence of the carboxyl (-COOH) group. The presence of the sulfanyl group may impart specific reactivity, including potential for nucleophilic substitution or oxidation reactions. Additionally, the bulky dimethyl groups can influence the steric hindrance around the carboxylic acid, potentially affecting its solubility and reactivity in various solvents. The compound may also exhibit interesting biological activity due to the presence of the thiol group, which is known for its role in redox reactions and interactions with biological molecules. Overall, 2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H14O2S
InChI:InChI=1/C11H14O2S/c1-11(2,10(12)13)7-8-3-5-9(14)6-4-8/h3-6,14H,7H2,1-2H3,(H,12,13)
SMILES:CC(C)(Cc1ccc(cc1)S)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.