CAS 887354-89-4
:1-(10-propanoyl-10,10a-dihydro-4aH-phenothiazin-2-yl)propan-1-one
Description:
1-(10-propanoyl-10,10a-dihydro-4aH-phenothiazin-2-yl)propan-1-one, identified by its CAS number 887354-89-4, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a propanoyl group attached to the phenothiazine core, which contributes to its potential biological activity. The presence of the carbonyl group (ketone) in the propan-1-one moiety suggests that it may participate in various chemical reactions, such as nucleophilic additions. The dihydro form indicates that the compound may exhibit reduced reactivity compared to fully aromatic derivatives. Its structural complexity may impart unique pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of antipsychotic or antidepressant agents. However, specific characteristics such as solubility, stability, and reactivity would depend on the compound's environment and conditions. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H19NO2S
InChI:InChI=1/C18H19NO2S/c1-3-15(20)12-9-10-17-14(11-12)19(18(21)4-2)13-7-5-6-8-16(13)22-17/h5-11,14,17H,3-4H2,1-2H3
SMILES:CCC(=O)C1=CC2C(C=C1)Sc1ccccc1N2C(=O)CC
Synonyms:- N,2-Dipropionyl Phenothiazine
- 4a,10a-Dihydro-2,10-bis(1-oxopropyl)-10H-phenothiazine
- 10H-Phenothiazine, 4a,10a-dihydro-2,10-bis(1-oxopropyl)- (9CI)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N,2-Dipropionyl Phenothiazine
CAS:Controlled ProductApplications A novel Phenothiazine (P318040) derivative.
Formula:C18H17NO2SColor and Shape:NeatMolecular weight:311.4


