CAS 887355-04-6
:ethyl 3-[4-(chlorosulfonyl)phenyl]-2,2-dimethylpropanoate
Description:
Ethyl 3-[4-(chlorosulfonyl)phenyl]-2,2-dimethylpropanoate is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a chlorosulfonyl group attached to a phenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the chlorosulfonyl group, which can participate in various chemical reactions, making it useful in synthetic organic chemistry. The presence of the dimethylpropanoate moiety contributes to its steric bulk, influencing its reactivity and interactions with other molecules. This compound may be utilized in the development of pharmaceuticals or agrochemicals, given its potential as an intermediate in chemical synthesis. Safety data sheets should be consulted for handling and storage guidelines, as compounds with chlorosulfonyl groups can be hazardous. Overall, ethyl 3-[4-(chlorosulfonyl)phenyl]-2,2-dimethylpropanoate exemplifies the diverse functionalities that can be engineered into organic molecules for specific applications.
Formula:C13H17ClO4S
InChI:InChI=1/C13H17ClO4S/c1-4-18-12(15)13(2,3)9-10-5-7-11(8-6-10)19(14,16)17/h5-8H,4,9H2,1-3H3
SMILES:CCOC(=O)C(C)(C)Cc1ccc(cc1)S(=O)(=O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenepropanoic acid,4-(chlorosulfonyl)-a,a-dimethyl-, ethyl ester
CAS:Formula:C13H17ClO4SColor and Shape:LiquidMolecular weight:304.7897
