CAS 887355-36-4

2-Fluoro-5-(3-pyridinyl)-2,4-pentadienoic acid

Description:

2-Fluoro-5-(3-pyridinyl)-2,4-pentadienoic acid is a chemical compound characterized by its unique structure, which includes a fluorine atom and a pyridine ring. This compound features a pentadienoic acid backbone, indicating the presence of conjugated double bonds, which can impart specific reactivity and stability properties. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, making it of interest in medicinal chemistry. The pyridine moiety contributes to the compound's potential interactions with biological targets, as pyridine derivatives are often found in pharmaceuticals. Additionally, the carboxylic acid functional group provides acidity and can participate in hydrogen bonding, affecting solubility and reactivity. Overall, 2-Fluoro-5-(3-pyridinyl)-2,4-pentadienoic acid is a compound of interest for research and development, particularly in the fields of organic synthesis and drug discovery, due to its structural features and potential applications.

Formula: C₁₀H₈FNO₂

InChI: InChI=1S/C10H8FNO2/c11-9(10(13)14)5-1-3-8-4-2-6-12-7-8/h1-7H,(H,13,14)

InChI key: InChIKey=POQFWZRTZMQLGP-UHFFFAOYSA-N

SMILES: C(=CC=C(C(O)=O)F)C=1C=CC=NC1

Synonyms:

• 2,4-Pentadienoic acid, 2-fluoro-5-(3-pyridinyl)-
• 2-Fluoro-5-(3-pyridinyl)-2,4-pentadienoic acid