CAS 887355-56-8
:N-(4-oxo-4-pyridin-3-ylbutyl)formamide
Description:
N-(4-oxo-4-pyridin-3-ylbutyl)formamide, identified by its CAS number 887355-56-8, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a formamide functional group, indicating that it contains a carbonyl group (C=O) directly bonded to an amine (NH2). The structure suggests that it may exhibit both polar and nonpolar characteristics due to the presence of the hydrophobic pyridine ring and the hydrophilic formamide group. This duality can influence its solubility in various solvents. Additionally, the compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the functional groups present, making it a candidate for further chemical modifications. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c13-8-12-6-2-4-10(14)9-3-1-5-11-7-9/h1,3,5,7-8H,2,4,6H2,(H,12,13)
SMILES:c1cc(cnc1)C(=O)CCCN=CO
Synonyms:- Formamide,N-[4-oxo-4-(3-pyridinyl)butyl]-
- N-[4-Oxo-4-(3-pyridinyl)butyl-formamide
- N-[4-Oxo-4-(3-pyridinyl)butyl-formamid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
3-(4-Formylaminobutyryl)pyridine
CAS:Formula:C10H12N2O2Color and Shape:SolidMolecular weight:192.21453-(4-Formylaminobutyryl)pyridine
CAS:Applications 3-(4-Formylaminobutyryl)pyridine (cas# 887355-56-8) is a compound useful in organic synthesis.
Formula:C10H12N2O2Color and Shape:NeatMolecular weight:192.213-(4-Formylaminobutyryl)pyridine-d4
CAS:Controlled ProductFormula:C10H8D4N2O2Color and Shape:NeatMolecular weight:196.24


