CymitQuimica logo

CAS 88736-76-9

:

butan-2-yl 4-chlorobutanoate

Description:
Butan-2-yl 4-chlorobutanoate, with the CAS number 88736-76-9, is an organic compound that belongs to the class of esters. It is characterized by the presence of a butan-2-yl group, which is a branched alkyl chain, and a 4-chlorobutanoate moiety, indicating the presence of a chlorine atom on the fourth carbon of the butanoate chain. This compound typically exhibits a moderate boiling point and is likely to be a colorless to pale yellow liquid at room temperature. Its structure suggests it may have applications in organic synthesis, potentially serving as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the chlorine atom can impart unique reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. Additionally, like many esters, it may have a characteristic fruity odor. Safety data should be consulted for handling and storage, as it may pose health risks if inhaled or ingested.
Formula:C8H15ClO2
InChI:InChI=1/C8H15ClO2/c1-3-7(2)11-8(10)5-4-6-9/h7H,3-6H2,1-2H3
Synonyms:
  • Butanoic acid, 4-chloro, 1-methylpropyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.